About 1-(3-fluorophenyl)ethyl 2-methyl-5-(2-pyrrolidin-1-ylethyl)-1H-indole-3-carboxylate
1-(3-fluorophenyl)ethyl 2-methyl-5-(2-pyrrolidin-1-ylethyl)-1H-indole-3-carboxylate (PubChem CID 10135265) has the molecular formula C24H27FN2O2
and a molecular weight of 394.49 g/mol. Its IUPAC name is 1-(3-fluorophenyl)ethyl 2-methyl-5-(2-pyrrolidin-1-ylethyl)-1H-indole-3-carboxylate.
Molecular Properties
| Compound Name | 1-(3-fluorophenyl)ethyl 2-methyl-5-(2-pyrrolidin-1-ylethyl)-1H-indole-3-carboxylate |
| PubChem CID | 10135265 |
| Molecular Formula | C24H27FN2O2 |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 1-(3-fluorophenyl)ethyl 2-methyl-5-(2-pyrrolidin-1-ylethyl)-1H-indole-3-carboxylate |
| SMILES | Cc1[nH]c2ccc(CCN3CCCC3)cc2c1C(=O)OC(C)c1cccc(F)c1 |
| InChI | InChI=1S/C24H27FN2O2/c1-16-23(24(28)29-17(2)19-6-5-7-20(25)15-19)21-14-18(8-9-22(21)26-16)10-13-27-11-3-4-12-27/h5-9,14-15,17,26H,3-4,10-13H2,1-2H3 |
| InChIKey | FVFNKSNJEZHJDX-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3-fluorophenyl)ethyl 2-methyl-5-(2-pyrrolidin-1-ylethyl)-1H-indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-fluorophenyl)ethyl 2-methyl-5-(2-pyrrolidin-1-ylethyl)-1H-indole-3-carboxylate?
The IUPAC name of 1-(3-fluorophenyl)ethyl 2-methyl-5-(2-pyrrolidin-1-ylethyl)-1H-indole-3-carboxylate (CID 10135265) is 1-(3-fluorophenyl)ethyl 2-methyl-5-(2-pyrrolidin-1-ylethyl)-1H-indole-3-carboxylate.
What is the SMILES notation for 1-(3-fluorophenyl)ethyl 2-methyl-5-(2-pyrrolidin-1-ylethyl)-1H-indole-3-carboxylate?
The canonical SMILES for 1-(3-fluorophenyl)ethyl 2-methyl-5-(2-pyrrolidin-1-ylethyl)-1H-indole-3-carboxylate is Cc1[nH]c2ccc(CCN3CCCC3)cc2c1C(=O)OC(C)c1cccc(F)c1.
What is the InChIKey of 1-(3-fluorophenyl)ethyl 2-methyl-5-(2-pyrrolidin-1-ylethyl)-1H-indole-3-carboxylate?
The InChIKey is FVFNKSNJEZHJDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27FN2O2/c1-16-23(24(28)29-17(2)19-6-5-7-20(25)15-19)21-14-18(8-9-22(21)26-16)10-13-27-11-3-4-12-27/h5-9,14-15,17,26H,3-4,10-13H2,1-2H3.
What are the key properties of 1-(3-fluorophenyl)ethyl 2-methyl-5-(2-pyrrolidin-1-ylethyl)-1H-indole-3-carboxylate?
1-(3-fluorophenyl)ethyl 2-methyl-5-(2-pyrrolidin-1-ylethyl)-1H-indole-3-carboxylate has a molecular weight of 394.49 g/mol, XLogP of 5.17, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-fluorophenyl)ethyl 2-methyl-5-(2-pyrrolidin-1-ylethyl)-1H-indole-3-carboxylate is sourced from PubChem (CID 10135265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).