C23H37NO2Si — CID 101353143
(2S,5S)-2-benzyl-5-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-1-methyl-2,5-dihydropyridin-6-one (PubChem CID 101353143) has the molecular formula C23H37NO2Si and a molecular weight of 387.64 g/mol. Its IUPAC name is (2S,5S)-2-benzyl-5-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-1-methyl-2,5-dihydropyridin-6-one.
| Compound Name | (2S,5S)-2-benzyl-5-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-1-methyl-2,5-dihydropyridin-6-one |
|---|---|
| PubChem CID | 101353143 |
| Molecular Formula | C23H37NO2Si |
| Molecular Weight | 387.64 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | (2S,5S)-2-benzyl-5-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-1-methyl-2,5-dihydropyridin-6-one |
| SMILES | CN1C(=O)[C@@H](CCCCO[Si](C)(C)C(C)(C)C)C=C[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C23H37NO2Si/c1-23(2,3)27(5,6)26-17-11-10-14-20-15-16-21(24(4)22(20)25)18-19-12-8-7-9-13-19/h7-9,12-13,15-16,20-21H,10-11,14,17-18H2,1-6H3/t20-,21+/m0/s1 |
| InChIKey | KDOMBHCYWBORRB-LEWJYISDSA-N |
| XLogP | 5.43 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.64 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|