C15H17NO4S — CID 101353324
methyl 4-[(4-methylphenyl)sulfonyl-prop-2-enylamino]but-2-ynoate (PubChem CID 101353324) has the molecular formula C15H17NO4S and a molecular weight of 307.37 g/mol. Its IUPAC name is methyl 4-[(4-methylphenyl)sulfonyl-prop-2-enylamino]but-2-ynoate.
| Compound Name | methyl 4-[(4-methylphenyl)sulfonyl-prop-2-enylamino]but-2-ynoate |
|---|---|
| PubChem CID | 101353324 |
| Molecular Formula | C15H17NO4S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | methyl 4-[(4-methylphenyl)sulfonyl-prop-2-enylamino]but-2-ynoate |
| SMILES | C=CCN(CC#CC(=O)OC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H17NO4S/c1-4-11-16(12-5-6-15(17)20-3)21(18,19)14-9-7-13(2)8-10-14/h4,7-10H,1,11-12H2,2-3H3 |
| InChIKey | WDCZYIGHFYVIPH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|