About 1-[(2S,3S)-3-phenyl-1-prop-2-enylaziridin-2-yl]prop-2-en-1-ol
1-[(2S,3S)-3-phenyl-1-prop-2-enylaziridin-2-yl]prop-2-en-1-ol (PubChem CID 101353403) has the molecular formula C14H17NO
and a molecular weight of 215.30 g/mol. Its IUPAC name is 1-[(2S,3S)-3-phenyl-1-prop-2-enylaziridin-2-yl]prop-2-en-1-ol.
Molecular Properties
| Compound Name | 1-[(2S,3S)-3-phenyl-1-prop-2-enylaziridin-2-yl]prop-2-en-1-ol |
| PubChem CID | 101353403 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 1-[(2S,3S)-3-phenyl-1-prop-2-enylaziridin-2-yl]prop-2-en-1-ol |
| SMILES | C=CCN1[C@H](C(O)C=C)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C14H17NO/c1-3-10-15-13(14(15)12(16)4-2)11-8-6-5-7-9-11/h3-9,12-14,16H,1-2,10H2/t12?,13-,14+,15?/m0/s1 |
| InChIKey | IHMOABZOBZANOX-RAFNIBEQSA-N |
| XLogP | 2.14 |
| TPSA | 23.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2S,3S)-3-phenyl-1-prop-2-enylaziridin-2-yl]prop-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S,3S)-3-phenyl-1-prop-2-enylaziridin-2-yl]prop-2-en-1-ol?
The IUPAC name of 1-[(2S,3S)-3-phenyl-1-prop-2-enylaziridin-2-yl]prop-2-en-1-ol (CID 101353403) is 1-[(2S,3S)-3-phenyl-1-prop-2-enylaziridin-2-yl]prop-2-en-1-ol.
What is the SMILES notation for 1-[(2S,3S)-3-phenyl-1-prop-2-enylaziridin-2-yl]prop-2-en-1-ol?
The canonical SMILES for 1-[(2S,3S)-3-phenyl-1-prop-2-enylaziridin-2-yl]prop-2-en-1-ol is C=CCN1[C@H](C(O)C=C)[C@@H]1c1ccccc1.
What is the InChIKey of 1-[(2S,3S)-3-phenyl-1-prop-2-enylaziridin-2-yl]prop-2-en-1-ol?
The InChIKey is IHMOABZOBZANOX-RAFNIBEQSA-N. The full InChI is InChI=1S/C14H17NO/c1-3-10-15-13(14(15)12(16)4-2)11-8-6-5-7-9-11/h3-9,12-14,16H,1-2,10H2/t12?,13-,14+,15?/m0/s1.
What are the key properties of 1-[(2S,3S)-3-phenyl-1-prop-2-enylaziridin-2-yl]prop-2-en-1-ol?
1-[(2S,3S)-3-phenyl-1-prop-2-enylaziridin-2-yl]prop-2-en-1-ol has a molecular weight of 215.30 g/mol, XLogP of 2.14, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S,3S)-3-phenyl-1-prop-2-enylaziridin-2-yl]prop-2-en-1-ol is sourced from PubChem (CID 101353403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).