C29H49O2+ — CID 101353438
(2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-1-ium-6-one (PubChem CID 101353438) has the molecular formula C29H49O2+ and a molecular weight of 429.71 g/mol. Its IUPAC name is (2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-1-ium-6-one.
| Compound Name | (2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-1-ium-6-one |
|---|---|
| PubChem CID | 101353438 |
| Molecular Formula | C29H49O2+ |
| Molecular Weight | 429.71 g/mol |
| Exact Mass | 429.37 |
| IUPAC Name | (2R)-2,5,7,8-tetramethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydrochromen-1-ium-6-one |
| SMILES | CC1=C(C)C2=[O+][C@](C)(CCC[C@H](C)CCC[C@H](C)CCCC(C)C)CCC2=C(C)C1=O |
| InChI | InChI=1S/C29H49O2/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-18-29(8)19-17-26-25(7)27(30)23(5)24(6)28(26)31-29/h20-22H,9-19H2,1-8H3/q+1/t21-,22-,29-/m1/s1 |
| InChIKey | YIDNSBWMUKAXLD-IEOSBIPESA-N |
| XLogP | 8.32 |
| TPSA | 28.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.71 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|