C36H59NO6Si3 — CID 101353452
N-[(3R,4R,5S,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-oxooxan-3-yl]acetamide (PubChem CID 101353452) has the molecular formula C36H59NO6Si3 and a molecular weight of 686.13 g/mol. Its IUPAC name is N-[(3R,4R,5S,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-oxooxan-3-yl]acetamide.
| Compound Name | N-[(3R,4R,5S,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-oxooxan-3-yl]acetamide |
|---|---|
| PubChem CID | 101353452 |
| Molecular Formula | C36H59NO6Si3 |
| Molecular Weight | 686.13 g/mol |
| Exact Mass | 685.37 |
| IUPAC Name | N-[(3R,4R,5S,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-oxooxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@H]1C(=O)O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C36H59NO6Si3/c1-26(38)37-30-32(43-45(13,14)35(5,6)7)31(42-44(11,12)34(2,3)4)29(41-33(30)39)25-40-46(36(8,9)10,27-21-17-15-18-22-27)28-23-19-16-20-24-28/h15-24,29-32H,25H2,1-14H3,(H,37,38)/t29-,30-,31+,32-/m1/s1 |
| InChIKey | IYUIWKNVPJOACU-FEFKUCBWSA-N |
| XLogP | 6.77 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.13 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|