About (2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methyl-dimethylazanium
(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methyl-dimethylazanium (PubChem CID 101353562) has the molecular formula C11H20NO2+
and a molecular weight of 198.29 g/mol. Its IUPAC name is (2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methyl-dimethylazanium.
Molecular Properties
| Compound Name | (2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methyl-dimethylazanium |
| PubChem CID | 101353562 |
| Molecular Formula | C11H20NO2+ |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | (2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methyl-dimethylazanium |
| SMILES | C[NH+](C)CC1=C(O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C11H19NO2/c1-11(2)5-9(13)8(7-12(3)4)10(14)6-11/h13H,5-7H2,1-4H3/p+1 |
| InChIKey | DFNYATILUDHLJB-UHFFFAOYSA-O |
| XLogP | 0.33 |
| TPSA | 41.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methyl-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methyl-dimethylazanium?
The IUPAC name of (2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methyl-dimethylazanium (CID 101353562) is (2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methyl-dimethylazanium.
What is the SMILES notation for (2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methyl-dimethylazanium?
The canonical SMILES for (2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methyl-dimethylazanium is C[NH+](C)CC1=C(O)CC(C)(C)CC1=O.
What is the InChIKey of (2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methyl-dimethylazanium?
The InChIKey is DFNYATILUDHLJB-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H19NO2/c1-11(2)5-9(13)8(7-12(3)4)10(14)6-11/h13H,5-7H2,1-4H3/p+1.
What are the key properties of (2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methyl-dimethylazanium?
(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methyl-dimethylazanium has a molecular weight of 198.29 g/mol, XLogP of 0.33, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methyl-dimethylazanium is sourced from PubChem (CID 101353562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).