C17H19F3O2 — CID 101353768
(2R,4R,6S)-2-ethenyl-4-methyl-6-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]oxan-4-ol (PubChem CID 101353768) has the molecular formula C17H19F3O2 and a molecular weight of 312.33 g/mol. Its IUPAC name is (2R,4R,6S)-2-ethenyl-4-methyl-6-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]oxan-4-ol.
| Compound Name | (2R,4R,6S)-2-ethenyl-4-methyl-6-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]oxan-4-ol |
|---|---|
| PubChem CID | 101353768 |
| Molecular Formula | C17H19F3O2 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | (2R,4R,6S)-2-ethenyl-4-methyl-6-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]oxan-4-ol |
| SMILES | C=C[C@H]1C[C@@](C)(O)C[C@@H](/C=C/c2ccc(C(F)(F)F)cc2)O1 |
| InChI | InChI=1S/C17H19F3O2/c1-3-14-10-16(2,21)11-15(22-14)9-6-12-4-7-13(8-5-12)17(18,19)20/h3-9,14-15,21H,1,10-11H2,2H3/b9-6+/t14-,15+,16+/m0/s1 |
| InChIKey | UNMFZYGXVSCJJG-HREYTXOFSA-N |
| XLogP | 4.20 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|