C25H34N2O6 — CID 101354370
tert-butyl (2S,3S,3aS,7aR)-3-[[[(2R,3S,3aS,8aS)-2-ethenyl-4-oxo-3,3a,6,8a-tetrahydro-2H-furo[3,2-c]oxepin-3-yl]amino]methyl]-2-ethenyl-3,3a,5,7a-tetrahydro-2H-furo[3,2-b]pyridine-4-carboxylate (PubChem CID 101354370) has the molecular formula C25H34N2O6 and a molecular weight of 458.56 g/mol. Its IUPAC name is tert-butyl (2S,3S,3aS,7aR)-3-[[[(2R,3S,3aS,8aS)-2-ethenyl-4-oxo-3,3a,6,8a-tetrahydro-2H-furo[3,2-c]oxepin-3-yl]amino]methyl]-2-ethenyl-3,3a,5,7a-tetrahydro-2H-furo[3,2-b]pyridine-4-carboxylate.
| Compound Name | tert-butyl (2S,3S,3aS,7aR)-3-[[[(2R,3S,3aS,8aS)-2-ethenyl-4-oxo-3,3a,6,8a-tetrahydro-2H-furo[3,2-c]oxepin-3-yl]amino]methyl]-2-ethenyl-3,3a,5,7a-tetrahydro-2H-furo[3,2-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 101354370 |
| Molecular Formula | C25H34N2O6 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | tert-butyl (2S,3S,3aS,7aR)-3-[[[(2R,3S,3aS,8aS)-2-ethenyl-4-oxo-3,3a,6,8a-tetrahydro-2H-furo[3,2-c]oxepin-3-yl]amino]methyl]-2-ethenyl-3,3a,5,7a-tetrahydro-2H-furo[3,2-b]pyridine-4-carboxylate |
| SMILES | C=C[C@@H]1O[C@@H]2C=CCN(C(=O)OC(C)(C)C)[C@H]2[C@@H]1CN[C@H]1[C@@H]2C(=O)OCC=C[C@@H]2O[C@@H]1C=C |
| InChI | InChI=1S/C25H34N2O6/c1-6-16-15(22-19(31-16)10-8-12-27(22)24(29)33-25(3,4)5)14-26-21-17(7-2)32-18-11-9-13-30-23(28)20(18)21/h6-11,15-22,26H,1-2,12-14H2,3-5H3/t15-,16+,17-,18+,19-,20-,21-,22+/m1/s1 |
| InChIKey | GIHQEPQEUFKHDJ-UCIUDWLLSA-N |
| XLogP | 2.37 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|