C23H26F21N2O4P — CID 101354483
4-[6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-henicosafluoropentadecoxy(morpholin-4-yl)phosphoryl]morpholine (PubChem CID 101354483) has the molecular formula C23H26F21N2O4P and a molecular weight of 824.40 g/mol. Its IUPAC name is 4-[6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-henicosafluoropentadecoxy(morpholin-4-yl)phosphoryl]morpholine.
| Compound Name | 4-[6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-henicosafluoropentadecoxy(morpholin-4-yl)phosphoryl]morpholine |
|---|---|
| PubChem CID | 101354483 |
| Molecular Formula | C23H26F21N2O4P |
| Molecular Weight | 824.40 g/mol |
| Exact Mass | 824.13 |
| IUPAC Name | 4-[6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,15-henicosafluoropentadecoxy(morpholin-4-yl)phosphoryl]morpholine |
| SMILES | O=P(OCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(N1CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C23H26F21N2O4P/c24-14(25,4-2-1-3-9-50-51(47,45-5-10-48-11-6-45)46-7-12-49-13-8-46)15(26,27)16(28,29)17(30,31)18(32,33)19(34,35)20(36,37)21(38,39)22(40,41)23(42,43)44/h1-13H2 |
| InChIKey | PYMHHQLZFRHUNL-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.40 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|