About 5-chloro-1-[(1R)-1-cyclopropylpropyl]-3-(5,7-dichloro-2,3-dihydroindol-1-yl)pyrazin-2-one
5-chloro-1-[(1R)-1-cyclopropylpropyl]-3-(5,7-dichloro-2,3-dihydroindol-1-yl)pyrazin-2-one (PubChem CID 10135525) has the molecular formula C18H18Cl3N3O
and a molecular weight of 398.72 g/mol. Its IUPAC name is 5-chloro-1-[(1R)-1-cyclopropylpropyl]-3-(5,7-dichloro-2,3-dihydroindol-1-yl)pyrazin-2-one.
Molecular Properties
| Compound Name | 5-chloro-1-[(1R)-1-cyclopropylpropyl]-3-(5,7-dichloro-2,3-dihydroindol-1-yl)pyrazin-2-one |
| PubChem CID | 10135525 |
| Molecular Formula | C18H18Cl3N3O |
| Molecular Weight | 398.72 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | 5-chloro-1-[(1R)-1-cyclopropylpropyl]-3-(5,7-dichloro-2,3-dihydroindol-1-yl)pyrazin-2-one |
| SMILES | CC[C@H](C1CC1)n1cc(Cl)nc(N2CCc3cc(Cl)cc(Cl)c32)c1=O |
| InChI | InChI=1S/C18H18Cl3N3O/c1-2-14(10-3-4-10)24-9-15(21)22-17(18(24)25)23-6-5-11-7-12(19)8-13(20)16(11)23/h7-10,14H,2-6H2,1H3/t14-/m1/s1 |
| InChIKey | BWNXWIOKVHHFOK-CQSZACIVSA-N |
| XLogP | 5.26 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.72 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-1-[(1R)-1-cyclopropylpropyl]-3-(5,7-dichloro-2,3-dihydroindol-1-yl)pyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1-[(1R)-1-cyclopropylpropyl]-3-(5,7-dichloro-2,3-dihydroindol-1-yl)pyrazin-2-one?
The IUPAC name of 5-chloro-1-[(1R)-1-cyclopropylpropyl]-3-(5,7-dichloro-2,3-dihydroindol-1-yl)pyrazin-2-one (CID 10135525) is 5-chloro-1-[(1R)-1-cyclopropylpropyl]-3-(5,7-dichloro-2,3-dihydroindol-1-yl)pyrazin-2-one.
What is the SMILES notation for 5-chloro-1-[(1R)-1-cyclopropylpropyl]-3-(5,7-dichloro-2,3-dihydroindol-1-yl)pyrazin-2-one?
The canonical SMILES for 5-chloro-1-[(1R)-1-cyclopropylpropyl]-3-(5,7-dichloro-2,3-dihydroindol-1-yl)pyrazin-2-one is CC[C@H](C1CC1)n1cc(Cl)nc(N2CCc3cc(Cl)cc(Cl)c32)c1=O.
What is the InChIKey of 5-chloro-1-[(1R)-1-cyclopropylpropyl]-3-(5,7-dichloro-2,3-dihydroindol-1-yl)pyrazin-2-one?
The InChIKey is BWNXWIOKVHHFOK-CQSZACIVSA-N. The full InChI is InChI=1S/C18H18Cl3N3O/c1-2-14(10-3-4-10)24-9-15(21)22-17(18(24)25)23-6-5-11-7-12(19)8-13(20)16(11)23/h7-10,14H,2-6H2,1H3/t14-/m1/s1.
What are the key properties of 5-chloro-1-[(1R)-1-cyclopropylpropyl]-3-(5,7-dichloro-2,3-dihydroindol-1-yl)pyrazin-2-one?
5-chloro-1-[(1R)-1-cyclopropylpropyl]-3-(5,7-dichloro-2,3-dihydroindol-1-yl)pyrazin-2-one has a molecular weight of 398.72 g/mol, XLogP of 5.26, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1-[(1R)-1-cyclopropylpropyl]-3-(5,7-dichloro-2,3-dihydroindol-1-yl)pyrazin-2-one is sourced from PubChem (CID 10135525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).