C41H46F6O2S2 — CID 101355264
5-(4-heptoxyphenyl)-3-[3,3,4,4,5,5-hexafluoro-2-[5-(4-heptoxyphenyl)-2-methylthiophen-3-yl]cyclopenten-1-yl]-2-methylthiophene (PubChem CID 101355264) has the molecular formula C41H46F6O2S2 and a molecular weight of 748.94 g/mol. Its IUPAC name is 5-(4-heptoxyphenyl)-3-[3,3,4,4,5,5-hexafluoro-2-[5-(4-heptoxyphenyl)-2-methylthiophen-3-yl]cyclopenten-1-yl]-2-methylthiophene.
| Compound Name | 5-(4-heptoxyphenyl)-3-[3,3,4,4,5,5-hexafluoro-2-[5-(4-heptoxyphenyl)-2-methylthiophen-3-yl]cyclopenten-1-yl]-2-methylthiophene |
|---|---|
| PubChem CID | 101355264 |
| Molecular Formula | C41H46F6O2S2 |
| Molecular Weight | 748.94 g/mol |
| Exact Mass | 748.28 |
| IUPAC Name | 5-(4-heptoxyphenyl)-3-[3,3,4,4,5,5-hexafluoro-2-[5-(4-heptoxyphenyl)-2-methylthiophen-3-yl]cyclopenten-1-yl]-2-methylthiophene |
| SMILES | CCCCCCCOc1ccc(-c2cc(C3=C(c4cc(-c5ccc(OCCCCCCC)cc5)sc4C)C(F)(F)C(F)(F)C3(F)F)c(C)s2)cc1 |
| InChI | InChI=1S/C41H46F6O2S2/c1-5-7-9-11-13-23-48-31-19-15-29(16-20-31)35-25-33(27(3)50-35)37-38(40(44,45)41(46,47)39(37,42)43)34-26-36(51-28(34)4)30-17-21-32(22-18-30)49-24-14-12-10-8-6-2/h15-22,25-26H,5-14,23-24H2,1-4H3 |
| InChIKey | XKKZGZGTRKQMIE-UHFFFAOYSA-N |
| XLogP | 14.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.94 |
| LogP ≤ 5 | 14.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|