C26H6F30S3 — CID 101356152
2,5-bis[3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)thiophen-2-yl]thiophene (PubChem CID 101356152) has the molecular formula C26H6F30S3 and a molecular weight of 984.47 g/mol. Its IUPAC name is 2,5-bis[3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)thiophen-2-yl]thiophene.
| Compound Name | 2,5-bis[3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)thiophen-2-yl]thiophene |
|---|---|
| PubChem CID | 101356152 |
| Molecular Formula | C26H6F30S3 |
| Molecular Weight | 984.47 g/mol |
| Exact Mass | 983.92 |
| IUPAC Name | 2,5-bis[3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)thiophen-2-yl]thiophene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c1ccsc1-c1ccc(-c2sccc2C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)s1 |
| InChI | InChI=1S/C26H6F30S3/c27-13(28,15(31,32)17(35,36)19(39,40)21(43,44)23(47,48)25(51,52)53)7-3-5-57-11(7)9-1-2-10(59-9)12-8(4-6-58-12)14(29,30)16(33,34)18(37,38)20(41,42)22(45,46)24(49,50)26(54,55)56/h1-6H |
| InChIKey | CYBWFJJLHKLFJV-UHFFFAOYSA-N |
| XLogP | 14.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 984.47 |
| LogP ≤ 5 | 14.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|