C26H35NOSi — CID 101356414
(3aR,8aR,8bR)-2,2-bis(2,4,6-trimethylphenyl)-3,3a,4,6,7,8,8a,8b-octahydrooxasilolo[5,4-a]pyrrolizine (PubChem CID 101356414) has the molecular formula C26H35NOSi and a molecular weight of 405.66 g/mol. Its IUPAC name is (3aR,8aR,8bR)-2,2-bis(2,4,6-trimethylphenyl)-3,3a,4,6,7,8,8a,8b-octahydrooxasilolo[5,4-a]pyrrolizine.
| Compound Name | (3aR,8aR,8bR)-2,2-bis(2,4,6-trimethylphenyl)-3,3a,4,6,7,8,8a,8b-octahydrooxasilolo[5,4-a]pyrrolizine |
|---|---|
| PubChem CID | 101356414 |
| Molecular Formula | C26H35NOSi |
| Molecular Weight | 405.66 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | (3aR,8aR,8bR)-2,2-bis(2,4,6-trimethylphenyl)-3,3a,4,6,7,8,8a,8b-octahydrooxasilolo[5,4-a]pyrrolizine |
| SMILES | Cc1cc(C)c([Si]2(c3c(C)cc(C)cc3C)C[C@@H]3CN4CCC[C@@H]4[C@@H]3O2)c(C)c1 |
| InChI | InChI=1S/C26H35NOSi/c1-16-10-18(3)25(19(4)11-16)29(26-20(5)12-17(2)13-21(26)6)15-22-14-27-9-7-8-23(27)24(22)28-29/h10-13,22-24H,7-9,14-15H2,1-6H3/t22-,23+,24+/m0/s1 |
| InChIKey | ZULVVSNBRIKBQR-RBZQAINGSA-N |
| XLogP | 4.09 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.66 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|