About 1-O-ethyl 4-O-methyl 2-[tert-butyl(dimethyl)silyl]oxy-3-methylidenebutanedioate
1-O-ethyl 4-O-methyl 2-[tert-butyl(dimethyl)silyl]oxy-3-methylidenebutanedioate (PubChem CID 101356968) has the molecular formula C14H26O5Si
and a molecular weight of 302.44 g/mol. Its IUPAC name is 1-O-ethyl 4-O-methyl 2-[tert-butyl(dimethyl)silyl]oxy-3-methylidenebutanedioate.
Molecular Properties
| Compound Name | 1-O-ethyl 4-O-methyl 2-[tert-butyl(dimethyl)silyl]oxy-3-methylidenebutanedioate |
| PubChem CID | 101356968 |
| Molecular Formula | C14H26O5Si |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 1-O-ethyl 4-O-methyl 2-[tert-butyl(dimethyl)silyl]oxy-3-methylidenebutanedioate |
| SMILES | C=C(C(=O)OC)C(O[Si](C)(C)C(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C14H26O5Si/c1-9-18-13(16)11(10(2)12(15)17-6)19-20(7,8)14(3,4)5/h11H,2,9H2,1,3-8H3 |
| InChIKey | VZRAWLZWUMLHCS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-O-ethyl 4-O-methyl 2-[tert-butyl(dimethyl)silyl]oxy-3-methylidenebutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 4-O-methyl 2-[tert-butyl(dimethyl)silyl]oxy-3-methylidenebutanedioate?
The IUPAC name of 1-O-ethyl 4-O-methyl 2-[tert-butyl(dimethyl)silyl]oxy-3-methylidenebutanedioate (CID 101356968) is 1-O-ethyl 4-O-methyl 2-[tert-butyl(dimethyl)silyl]oxy-3-methylidenebutanedioate.
What is the SMILES notation for 1-O-ethyl 4-O-methyl 2-[tert-butyl(dimethyl)silyl]oxy-3-methylidenebutanedioate?
The canonical SMILES for 1-O-ethyl 4-O-methyl 2-[tert-butyl(dimethyl)silyl]oxy-3-methylidenebutanedioate is C=C(C(=O)OC)C(O[Si](C)(C)C(C)(C)C)C(=O)OCC.
What is the InChIKey of 1-O-ethyl 4-O-methyl 2-[tert-butyl(dimethyl)silyl]oxy-3-methylidenebutanedioate?
The InChIKey is VZRAWLZWUMLHCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O5Si/c1-9-18-13(16)11(10(2)12(15)17-6)19-20(7,8)14(3,4)5/h11H,2,9H2,1,3-8H3.
What are the key properties of 1-O-ethyl 4-O-methyl 2-[tert-butyl(dimethyl)silyl]oxy-3-methylidenebutanedioate?
1-O-ethyl 4-O-methyl 2-[tert-butyl(dimethyl)silyl]oxy-3-methylidenebutanedioate has a molecular weight of 302.44 g/mol, XLogP of 2.67, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 4-O-methyl 2-[tert-butyl(dimethyl)silyl]oxy-3-methylidenebutanedioate is sourced from PubChem (CID 101356968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).