C34H36I2O8S8 — CID 101357189
dibutyl 2-[4-[2-[2-[4,5-bis(butoxycarbonyl)-1,3-dithiol-2-ylidene]-5-iodo-1,3-dithiol-4-yl]ethynyl]-5-iodo-1,3-dithiol-2-ylidene]-1,3-dithiole-4,5-dicarboxylate (PubChem CID 101357189) has the molecular formula C34H36I2O8S8 and a molecular weight of 1083.00 g/mol. Its IUPAC name is dibutyl 2-[4-[2-[2-[4,5-bis(butoxycarbonyl)-1,3-dithiol-2-ylidene]-5-iodo-1,3-dithiol-4-yl]ethynyl]-5-iodo-1,3-dithiol-2-ylidene]-1,3-dithiole-4,5-dicarboxylate.
| Compound Name | dibutyl 2-[4-[2-[2-[4,5-bis(butoxycarbonyl)-1,3-dithiol-2-ylidene]-5-iodo-1,3-dithiol-4-yl]ethynyl]-5-iodo-1,3-dithiol-2-ylidene]-1,3-dithiole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 101357189 |
| Molecular Formula | C34H36I2O8S8 |
| Molecular Weight | 1083.00 g/mol |
| Exact Mass | 1081.83 |
| IUPAC Name | dibutyl 2-[4-[2-[2-[4,5-bis(butoxycarbonyl)-1,3-dithiol-2-ylidene]-5-iodo-1,3-dithiol-4-yl]ethynyl]-5-iodo-1,3-dithiol-2-ylidene]-1,3-dithiole-4,5-dicarboxylate |
| SMILES | CCCCOC(=O)C1=C(C(=O)OCCCC)SC(=C2SC(I)=C(C#CC3=C(I)SC(=C4SC(C(=O)OCCCC)=C(C(=O)OCCCC)S4)S3)S2)S1 |
| InChI | InChI=1S/C34H36I2O8S8/c1-5-9-15-41-27(37)21-22(28(38)42-16-10-6-2)48-33(47-21)31-45-19(25(35)51-31)13-14-20-26(36)52-32(46-20)34-49-23(29(39)43-17-11-7-3)24(50-34)30(40)44-18-12-8-4/h5-12,15-18H2,1-4H3 |
| InChIKey | MQKNHROJKDHZOJ-UHFFFAOYSA-N |
| XLogP | 12.17 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1083.00 |
| LogP ≤ 5 | 12.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|