About 5-ethenyl-4,4-dipentyl-1,3-dioxolan-2-one
5-ethenyl-4,4-dipentyl-1,3-dioxolan-2-one (PubChem CID 101357390) has the molecular formula C15H26O3
and a molecular weight of 254.37 g/mol. Its IUPAC name is 5-ethenyl-4,4-dipentyl-1,3-dioxolan-2-one.
Molecular Properties
| Compound Name | 5-ethenyl-4,4-dipentyl-1,3-dioxolan-2-one |
| PubChem CID | 101357390 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 5-ethenyl-4,4-dipentyl-1,3-dioxolan-2-one |
| SMILES | C=CC1OC(=O)OC1(CCCCC)CCCCC |
| InChI | InChI=1S/C15H26O3/c1-4-7-9-11-15(12-10-8-5-2)13(6-3)17-14(16)18-15/h6,13H,3-5,7-12H2,1-2H3 |
| InChIKey | RBSISWCMCQSDKF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-ethenyl-4,4-dipentyl-1,3-dioxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-4,4-dipentyl-1,3-dioxolan-2-one?
The IUPAC name of 5-ethenyl-4,4-dipentyl-1,3-dioxolan-2-one (CID 101357390) is 5-ethenyl-4,4-dipentyl-1,3-dioxolan-2-one.
What is the SMILES notation for 5-ethenyl-4,4-dipentyl-1,3-dioxolan-2-one?
The canonical SMILES for 5-ethenyl-4,4-dipentyl-1,3-dioxolan-2-one is C=CC1OC(=O)OC1(CCCCC)CCCCC.
What is the InChIKey of 5-ethenyl-4,4-dipentyl-1,3-dioxolan-2-one?
The InChIKey is RBSISWCMCQSDKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O3/c1-4-7-9-11-15(12-10-8-5-2)13(6-3)17-14(16)18-15/h6,13H,3-5,7-12H2,1-2H3.
What are the key properties of 5-ethenyl-4,4-dipentyl-1,3-dioxolan-2-one?
5-ethenyl-4,4-dipentyl-1,3-dioxolan-2-one has a molecular weight of 254.37 g/mol, XLogP of 4.61, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-4,4-dipentyl-1,3-dioxolan-2-one is sourced from PubChem (CID 101357390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).