C12H13Cl3N2O5 — CID 101357408
ethyl (4S,5R,6S)-6-(furan-2-yl)-4-hydroxy-2-oxo-4-(trichloromethyl)-1,3-diazinane-5-carboxylate (PubChem CID 101357408) has the molecular formula C12H13Cl3N2O5 and a molecular weight of 371.60 g/mol. Its IUPAC name is ethyl (4S,5R,6S)-6-(furan-2-yl)-4-hydroxy-2-oxo-4-(trichloromethyl)-1,3-diazinane-5-carboxylate.
| Compound Name | ethyl (4S,5R,6S)-6-(furan-2-yl)-4-hydroxy-2-oxo-4-(trichloromethyl)-1,3-diazinane-5-carboxylate |
|---|---|
| PubChem CID | 101357408 |
| Molecular Formula | C12H13Cl3N2O5 |
| Molecular Weight | 371.60 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | ethyl (4S,5R,6S)-6-(furan-2-yl)-4-hydroxy-2-oxo-4-(trichloromethyl)-1,3-diazinane-5-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H](c2ccco2)NC(=O)N[C@@]1(O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H13Cl3N2O5/c1-2-21-9(18)7-8(6-4-3-5-22-6)16-10(19)17-11(7,20)12(13,14)15/h3-5,7-8,20H,2H2,1H3,(H2,16,17,19)/t7-,8+,11-/m0/s1 |
| InChIKey | WUVBJDFIXVDHQZ-RNSXUZJQSA-N |
| XLogP | 1.87 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.60 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|