About [[bis(trimethylsilyl)amino]-(trimethylsilylamino)-trimethylsilylimino-λ5-phosphanyl]ethane
[[bis(trimethylsilyl)amino]-(trimethylsilylamino)-trimethylsilylimino-λ5-phosphanyl]ethane (PubChem CID 101357578) has the molecular formula C14H42N3PSi4
and a molecular weight of 395.83 g/mol. Its IUPAC name is [[bis(trimethylsilyl)amino]-(trimethylsilylamino)-trimethylsilylimino-λ5-phosphanyl]ethane.
Molecular Properties
| Compound Name | [[bis(trimethylsilyl)amino]-(trimethylsilylamino)-trimethylsilylimino-λ5-phosphanyl]ethane |
| PubChem CID | 101357578 |
| Molecular Formula | C14H42N3PSi4 |
| Molecular Weight | 395.83 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | [[bis(trimethylsilyl)amino]-(trimethylsilylamino)-trimethylsilylimino-λ5-phosphanyl]ethane |
| SMILES | CCP(=N[Si](C)(C)C)(N[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C14H42N3PSi4/c1-14-18(15-19(2,3)4,16-20(5,6)7)17(21(8,9)10)22(11,12)13/h15H,14H2,1-13H3 |
| InChIKey | ORZYVKNHYKBFTR-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.83 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [[bis(trimethylsilyl)amino]-(trimethylsilylamino)-trimethylsilylimino-λ5-phosphanyl]ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[bis(trimethylsilyl)amino]-(trimethylsilylamino)-trimethylsilylimino-λ5-phosphanyl]ethane?
The IUPAC name of [[bis(trimethylsilyl)amino]-(trimethylsilylamino)-trimethylsilylimino-λ5-phosphanyl]ethane (CID 101357578) is [[bis(trimethylsilyl)amino]-(trimethylsilylamino)-trimethylsilylimino-λ5-phosphanyl]ethane.
What is the SMILES notation for [[bis(trimethylsilyl)amino]-(trimethylsilylamino)-trimethylsilylimino-λ5-phosphanyl]ethane?
The canonical SMILES for [[bis(trimethylsilyl)amino]-(trimethylsilylamino)-trimethylsilylimino-λ5-phosphanyl]ethane is CCP(=N[Si](C)(C)C)(N[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C.
What is the InChIKey of [[bis(trimethylsilyl)amino]-(trimethylsilylamino)-trimethylsilylimino-λ5-phosphanyl]ethane?
The InChIKey is ORZYVKNHYKBFTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H42N3PSi4/c1-14-18(15-19(2,3)4,16-20(5,6)7)17(21(8,9)10)22(11,12)13/h15H,14H2,1-13H3.
What are the key properties of [[bis(trimethylsilyl)amino]-(trimethylsilylamino)-trimethylsilylimino-λ5-phosphanyl]ethane?
[[bis(trimethylsilyl)amino]-(trimethylsilylamino)-trimethylsilylimino-λ5-phosphanyl]ethane has a molecular weight of 395.83 g/mol, XLogP of 6.27, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [[bis(trimethylsilyl)amino]-(trimethylsilylamino)-trimethylsilylimino-λ5-phosphanyl]ethane is sourced from PubChem (CID 101357578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).