C8H11Cl3O4 — CID 101357597
methyl (E)-2-chloro-3-(dichloromethyl)-4,4-dimethoxybut-2-enoate (PubChem CID 101357597) has the molecular formula C8H11Cl3O4 and a molecular weight of 277.53 g/mol. Its IUPAC name is methyl (E)-2-chloro-3-(dichloromethyl)-4,4-dimethoxybut-2-enoate.
| Compound Name | methyl (E)-2-chloro-3-(dichloromethyl)-4,4-dimethoxybut-2-enoate |
|---|---|
| PubChem CID | 101357597 |
| Molecular Formula | C8H11Cl3O4 |
| Molecular Weight | 277.53 g/mol |
| Exact Mass | 275.97 |
| IUPAC Name | methyl (E)-2-chloro-3-(dichloromethyl)-4,4-dimethoxybut-2-enoate |
| SMILES | COC(=O)/C(Cl)=C(\C(Cl)Cl)C(OC)OC |
| InChI | InChI=1S/C8H11Cl3O4/c1-13-7(12)5(9)4(6(10)11)8(14-2)15-3/h6,8H,1-3H3/b5-4- |
| InChIKey | HIVBGPATJNCDOV-PLNGDYQASA-N |
| XLogP | 2.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.53 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|