C16H11N3S — CID 101357599
2-(4-isothiocyanatophenyl)-1,3-dihydroisoindole-1-carbonitrile (PubChem CID 101357599) has the molecular formula C16H11N3S and a molecular weight of 277.35 g/mol. Its IUPAC name is 2-(4-isothiocyanatophenyl)-1,3-dihydroisoindole-1-carbonitrile.
| Compound Name | 2-(4-isothiocyanatophenyl)-1,3-dihydroisoindole-1-carbonitrile |
|---|---|
| PubChem CID | 101357599 |
| Molecular Formula | C16H11N3S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 2-(4-isothiocyanatophenyl)-1,3-dihydroisoindole-1-carbonitrile |
| SMILES | N#CC1c2ccccc2CN1c1ccc(N=C=S)cc1 |
| InChI | InChI=1S/C16H11N3S/c17-9-16-15-4-2-1-3-12(15)10-19(16)14-7-5-13(6-8-14)18-11-20/h1-8,16H,10H2 |
| InChIKey | GTKNWVYSHUJANC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|