C54H24F18O6 — CID 101357600
1,2,3,4,5,6-hexakis[4-(1,2,2-trifluoroethenoxy)phenyl]benzene (PubChem CID 101357600) has the molecular formula C54H24F18O6 and a molecular weight of 1110.74 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexakis[4-(1,2,2-trifluoroethenoxy)phenyl]benzene.
| Compound Name | 1,2,3,4,5,6-hexakis[4-(1,2,2-trifluoroethenoxy)phenyl]benzene |
|---|---|
| PubChem CID | 101357600 |
| Molecular Formula | C54H24F18O6 |
| Molecular Weight | 1110.74 g/mol |
| Exact Mass | 1110.13 |
| IUPAC Name | 1,2,3,4,5,6-hexakis[4-(1,2,2-trifluoroethenoxy)phenyl]benzene |
| SMILES | FC(F)=C(F)Oc1ccc(-c2c(-c3ccc(OC(F)=C(F)F)cc3)c(-c3ccc(OC(F)=C(F)F)cc3)c(-c3ccc(OC(F)=C(F)F)cc3)c(-c3ccc(OC(F)=C(F)F)cc3)c2-c2ccc(OC(F)=C(F)F)cc2)cc1 |
| InChI | InChI=1S/C54H24F18O6/c55-43(56)49(67)73-31-13-1-25(2-14-31)37-38(26-3-15-32(16-4-26)74-50(68)44(57)58)40(28-7-19-34(20-8-28)76-52(70)46(61)62)42(30-11-23-36(24-12-30)78-54(72)48(65)66)41(29-9-21-35(22-10-29)77-53(71)47(63)64)39(37)27-5-17-33(18-6-27)75-51(69)45(59)60/h1-24H |
| InChIKey | FVJPQCRRCCYOOZ-UHFFFAOYSA-N |
| XLogP | 20.17 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1110.74 |
| LogP ≤ 5 | 20.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|