C23H26Cl3NO2Si — CID 101357737
N-[(1R,5R)-5-[tert-butyl(diphenyl)silyl]oxycyclopent-2-en-1-yl]-2,2,2-trichloroacetamide (PubChem CID 101357737) has the molecular formula C23H26Cl3NO2Si and a molecular weight of 482.91 g/mol. Its IUPAC name is N-[(1R,5R)-5-[tert-butyl(diphenyl)silyl]oxycyclopent-2-en-1-yl]-2,2,2-trichloroacetamide.
| Compound Name | N-[(1R,5R)-5-[tert-butyl(diphenyl)silyl]oxycyclopent-2-en-1-yl]-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 101357737 |
| Molecular Formula | C23H26Cl3NO2Si |
| Molecular Weight | 482.91 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | N-[(1R,5R)-5-[tert-butyl(diphenyl)silyl]oxycyclopent-2-en-1-yl]-2,2,2-trichloroacetamide |
| SMILES | CC(C)(C)[Si](O[C@@H]1CC=C[C@H]1NC(=O)C(Cl)(Cl)Cl)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H26Cl3NO2Si/c1-22(2,3)30(17-11-6-4-7-12-17,18-13-8-5-9-14-18)29-20-16-10-15-19(20)27-21(28)23(24,25)26/h4-15,19-20H,16H2,1-3H3,(H,27,28)/t19-,20-/m1/s1 |
| InChIKey | VQYRBLUXPBQADD-WOJBJXKFSA-N |
| XLogP | 4.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.91 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|