C22H21N5O3 — CID 10135786
4-N-quinolin-6-yl-2-N-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-diamine (PubChem CID 10135786) has the molecular formula C22H21N5O3 and a molecular weight of 403.44 g/mol. Its IUPAC name is 4-N-quinolin-6-yl-2-N-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-quinolin-6-yl-2-N-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 10135786 |
| Molecular Formula | C22H21N5O3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 4-N-quinolin-6-yl-2-N-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-diamine |
| SMILES | COc1cc(Nc2nccc(Nc3ccc4ncccc4c3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C22H21N5O3/c1-28-18-12-16(13-19(29-2)21(18)30-3)26-22-24-10-8-20(27-22)25-15-6-7-17-14(11-15)5-4-9-23-17/h4-13H,1-3H3,(H2,24,25,26,27) |
| InChIKey | QZNAGOWOUWHEEI-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |