About methyl 2-phenyl-2-[[2-(1,3-thiazol-2-yl)quinoline-4-carbonyl]amino]acetate
methyl 2-phenyl-2-[[2-(1,3-thiazol-2-yl)quinoline-4-carbonyl]amino]acetate (PubChem CID 10135793) has the molecular formula C22H17N3O3S
and a molecular weight of 403.46 g/mol. Its IUPAC name is methyl 2-phenyl-2-[[2-(1,3-thiazol-2-yl)quinoline-4-carbonyl]amino]acetate.
Molecular Properties
| Compound Name | methyl 2-phenyl-2-[[2-(1,3-thiazol-2-yl)quinoline-4-carbonyl]amino]acetate |
| PubChem CID | 10135793 |
| Molecular Formula | C22H17N3O3S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | methyl 2-phenyl-2-[[2-(1,3-thiazol-2-yl)quinoline-4-carbonyl]amino]acetate |
| SMILES | COC(=O)C(NC(=O)c1cc(-c2nccs2)nc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C22H17N3O3S/c1-28-22(27)19(14-7-3-2-4-8-14)25-20(26)16-13-18(21-23-11-12-29-21)24-17-10-6-5-9-15(16)17/h2-13,19H,1H3,(H,25,26) |
| InChIKey | CBALMYJAYBVGIF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-phenyl-2-[[2-(1,3-thiazol-2-yl)quinoline-4-carbonyl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-phenyl-2-[[2-(1,3-thiazol-2-yl)quinoline-4-carbonyl]amino]acetate?
The IUPAC name of methyl 2-phenyl-2-[[2-(1,3-thiazol-2-yl)quinoline-4-carbonyl]amino]acetate (CID 10135793) is methyl 2-phenyl-2-[[2-(1,3-thiazol-2-yl)quinoline-4-carbonyl]amino]acetate.
What is the SMILES notation for methyl 2-phenyl-2-[[2-(1,3-thiazol-2-yl)quinoline-4-carbonyl]amino]acetate?
The canonical SMILES for methyl 2-phenyl-2-[[2-(1,3-thiazol-2-yl)quinoline-4-carbonyl]amino]acetate is COC(=O)C(NC(=O)c1cc(-c2nccs2)nc2ccccc12)c1ccccc1.
What is the InChIKey of methyl 2-phenyl-2-[[2-(1,3-thiazol-2-yl)quinoline-4-carbonyl]amino]acetate?
The InChIKey is CBALMYJAYBVGIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17N3O3S/c1-28-22(27)19(14-7-3-2-4-8-14)25-20(26)16-13-18(21-23-11-12-29-21)24-17-10-6-5-9-15(16)17/h2-13,19H,1H3,(H,25,26).
What are the key properties of methyl 2-phenyl-2-[[2-(1,3-thiazol-2-yl)quinoline-4-carbonyl]amino]acetate?
methyl 2-phenyl-2-[[2-(1,3-thiazol-2-yl)quinoline-4-carbonyl]amino]acetate has a molecular weight of 403.46 g/mol, XLogP of 4.00, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-phenyl-2-[[2-(1,3-thiazol-2-yl)quinoline-4-carbonyl]amino]acetate is sourced from PubChem (CID 10135793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).