C37H72N4O12Si2 — CID 101357985
[2,2-bis[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-3-(3-triethoxysilylpropylcarbamoyloxy)propyl] N-(3-triethoxysilylpropyl)carbamate (PubChem CID 101357985) has the molecular formula C37H72N4O12Si2 and a molecular weight of 821.17 g/mol. Its IUPAC name is [2,2-bis[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-3-(3-triethoxysilylpropylcarbamoyloxy)propyl] N-(3-triethoxysilylpropyl)carbamate.
| Compound Name | [2,2-bis[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-3-(3-triethoxysilylpropylcarbamoyloxy)propyl] N-(3-triethoxysilylpropyl)carbamate |
|---|---|
| PubChem CID | 101357985 |
| Molecular Formula | C37H72N4O12Si2 |
| Molecular Weight | 821.17 g/mol |
| Exact Mass | 820.47 |
| IUPAC Name | [2,2-bis[(4S)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-3-(3-triethoxysilylpropylcarbamoyloxy)propyl] N-(3-triethoxysilylpropyl)carbamate |
| SMILES | CCO[Si](CCCNC(=O)OCC(COC(=O)NCCC[Si](OCC)(OCC)OCC)(C1=N[C@@H](C(C)(C)C)CO1)C1=N[C@@H](C(C)(C)C)CO1)(OCC)OCC |
| InChI | InChI=1S/C37H72N4O12Si2/c1-13-48-54(49-14-2,50-15-3)23-19-21-38-33(42)46-27-37(31-40-29(25-44-31)35(7,8)9,32-41-30(26-45-32)36(10,11)12)28-47-34(43)39-22-20-24-55(51-16-4,52-17-5)53-18-6/h29-30H,13-28H2,1-12H3,(H,38,42)(H,39,43)/t29-,30-/m1/s1 |
| InChIKey | ICBKDXMGPJYJDR-LOYHVIPDSA-N |
| XLogP | 5.99 |
| TPSA | 175.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.17 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|