C16H15FN2O2 — CID 101357990
(2R,7R)-7-fluoro-3,5-dimethyl-3,5-diazatetracyclo[6.6.2.02,7.09,14]hexadeca-9,11,13,15-tetraene-4,6-dione (PubChem CID 101357990) has the molecular formula C16H15FN2O2 and a molecular weight of 286.31 g/mol. Its IUPAC name is (2R,7R)-7-fluoro-3,5-dimethyl-3,5-diazatetracyclo[6.6.2.02,7.09,14]hexadeca-9,11,13,15-tetraene-4,6-dione.
| Compound Name | (2R,7R)-7-fluoro-3,5-dimethyl-3,5-diazatetracyclo[6.6.2.02,7.09,14]hexadeca-9,11,13,15-tetraene-4,6-dione |
|---|---|
| PubChem CID | 101357990 |
| Molecular Formula | C16H15FN2O2 |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | (2R,7R)-7-fluoro-3,5-dimethyl-3,5-diazatetracyclo[6.6.2.02,7.09,14]hexadeca-9,11,13,15-tetraene-4,6-dione |
| SMILES | CN1C(=O)N(C)[C@@H]2C3C=CC(c4ccccc43)[C@]2(F)C1=O |
| InChI | InChI=1S/C16H15FN2O2/c1-18-13-11-7-8-12(10-6-4-3-5-9(10)11)16(13,17)14(20)19(2)15(18)21/h3-8,11-13H,1-2H3/t11?,12?,13-,16-/m1/s1 |
| InChIKey | PSHHGPPCVROSTK-UXTNIJRTSA-N |
| XLogP | 2.04 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|