C13H17F3O2 — CID 101358450
2,2,2-trifluoroethyl (1S,2R,4R)-2,3,3-trimethylbicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 101358450) has the molecular formula C13H17F3O2 and a molecular weight of 262.27 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl (1S,2R,4R)-2,3,3-trimethylbicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl (1S,2R,4R)-2,3,3-trimethylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 101358450 |
| Molecular Formula | C13H17F3O2 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 2,2,2-trifluoroethyl (1S,2R,4R)-2,3,3-trimethylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC1(C)[C@H]2C=C[C@H](C2)[C@@]1(C)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C13H17F3O2/c1-11(2)8-4-5-9(6-8)12(11,3)10(17)18-7-13(14,15)16/h4-5,8-9H,6-7H2,1-3H3/t8-,9+,12-/m0/s1 |
| InChIKey | AKXLXEFFKLWMJW-SBMIAAHKSA-N |
| XLogP | 3.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|