C50H58O4Si2 — CID 101358466
2,6-bis[4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl]-1,3,5,7-tetrahydro-s-indacene-2,6-dicarbaldehyde (PubChem CID 101358466) has the molecular formula C50H58O4Si2 and a molecular weight of 779.18 g/mol. Its IUPAC name is 2,6-bis[4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl]-1,3,5,7-tetrahydro-s-indacene-2,6-dicarbaldehyde.
| Compound Name | 2,6-bis[4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl]-1,3,5,7-tetrahydro-s-indacene-2,6-dicarbaldehyde |
|---|---|
| PubChem CID | 101358466 |
| Molecular Formula | C50H58O4Si2 |
| Molecular Weight | 779.18 g/mol |
| Exact Mass | 778.39 |
| IUPAC Name | 2,6-bis[4-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]phenyl]-1,3,5,7-tetrahydro-s-indacene-2,6-dicarbaldehyde |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(-c2ccc(C3(C=O)Cc4cc5c(cc4C3)CC(C=O)(c3ccc(-c4ccc(O[Si](C)(C)C(C)(C)C)cc4)cc3)C5)cc2)cc1 |
| InChI | InChI=1S/C50H58O4Si2/c1-47(2,3)55(7,8)53-45-23-15-37(16-24-45)35-11-19-43(20-12-35)49(33-51)29-39-27-41-31-50(34-52,32-42(41)28-40(39)30-49)44-21-13-36(14-22-44)38-17-25-46(26-18-38)54-56(9,10)48(4,5)6/h11-28,33-34H,29-32H2,1-10H3 |
| InChIKey | VPEQZYCAJOMALX-UHFFFAOYSA-N |
| XLogP | 12.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.18 |
| LogP ≤ 5 | 12.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|