About 3-tert-butyl-1-methoxy-5,7-di(propan-2-ylidene)cycloheptene
3-tert-butyl-1-methoxy-5,7-di(propan-2-ylidene)cycloheptene (PubChem CID 101358688) has the molecular formula C18H30O
and a molecular weight of 262.44 g/mol. Its IUPAC name is 3-tert-butyl-1-methoxy-5,7-di(propan-2-ylidene)cycloheptene.
Molecular Properties
| Compound Name | 3-tert-butyl-1-methoxy-5,7-di(propan-2-ylidene)cycloheptene |
| PubChem CID | 101358688 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | 3-tert-butyl-1-methoxy-5,7-di(propan-2-ylidene)cycloheptene |
| SMILES | COC1=CC(C(C)(C)C)CC(=C(C)C)CC1=C(C)C |
| InChI | InChI=1S/C18H30O/c1-12(2)14-9-15(18(5,6)7)11-17(19-8)16(10-14)13(3)4/h11,15H,9-10H2,1-8H3 |
| InChIKey | PKPMXAZUQOFGHX-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-tert-butyl-1-methoxy-5,7-di(propan-2-ylidene)cycloheptene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-1-methoxy-5,7-di(propan-2-ylidene)cycloheptene?
The IUPAC name of 3-tert-butyl-1-methoxy-5,7-di(propan-2-ylidene)cycloheptene (CID 101358688) is 3-tert-butyl-1-methoxy-5,7-di(propan-2-ylidene)cycloheptene.
What is the SMILES notation for 3-tert-butyl-1-methoxy-5,7-di(propan-2-ylidene)cycloheptene?
The canonical SMILES for 3-tert-butyl-1-methoxy-5,7-di(propan-2-ylidene)cycloheptene is COC1=CC(C(C)(C)C)CC(=C(C)C)CC1=C(C)C.
What is the InChIKey of 3-tert-butyl-1-methoxy-5,7-di(propan-2-ylidene)cycloheptene?
The InChIKey is PKPMXAZUQOFGHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O/c1-12(2)14-9-15(18(5,6)7)11-17(19-8)16(10-14)13(3)4/h11,15H,9-10H2,1-8H3.
What are the key properties of 3-tert-butyl-1-methoxy-5,7-di(propan-2-ylidene)cycloheptene?
3-tert-butyl-1-methoxy-5,7-di(propan-2-ylidene)cycloheptene has a molecular weight of 262.44 g/mol, XLogP of 5.65, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-1-methoxy-5,7-di(propan-2-ylidene)cycloheptene is sourced from PubChem (CID 101358688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).