C16H8N2S5 — CID 101359101
4,9-bis(1,3-dithiol-2-ylidene)benzo[f][2,1,3]benzothiadiazole (PubChem CID 101359101) has the molecular formula C16H8N2S5 and a molecular weight of 388.59 g/mol. Its IUPAC name is 4,9-bis(1,3-dithiol-2-ylidene)benzo[f][2,1,3]benzothiadiazole.
| Compound Name | 4,9-bis(1,3-dithiol-2-ylidene)benzo[f][2,1,3]benzothiadiazole |
|---|---|
| PubChem CID | 101359101 |
| Molecular Formula | C16H8N2S5 |
| Molecular Weight | 388.59 g/mol |
| Exact Mass | 387.93 |
| IUPAC Name | 4,9-bis(1,3-dithiol-2-ylidene)benzo[f][2,1,3]benzothiadiazole |
| SMILES | C1=CSC(=c2c3ccccc3c(=C3SC=CS3)c3nsnc23)S1 |
| InChI | InChI=1S/C16H8N2S5/c1-2-4-10-9(3-1)11(15-19-5-6-20-15)13-14(18-23-17-13)12(10)16-21-7-8-22-16/h1-8H |
| InChIKey | QLUOVBVQTMJJFE-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.59 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |