About (3S,4S)-2-benzyl-3-phenyl-1,2-oxazolidine-4-carbaldehyde
(3S,4S)-2-benzyl-3-phenyl-1,2-oxazolidine-4-carbaldehyde (PubChem CID 101359340) has the molecular formula C17H17NO2
and a molecular weight of 267.33 g/mol. Its IUPAC name is (3S,4S)-2-benzyl-3-phenyl-1,2-oxazolidine-4-carbaldehyde.
Molecular Properties
| Compound Name | (3S,4S)-2-benzyl-3-phenyl-1,2-oxazolidine-4-carbaldehyde |
| PubChem CID | 101359340 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | (3S,4S)-2-benzyl-3-phenyl-1,2-oxazolidine-4-carbaldehyde |
| SMILES | O=C[C@@H]1CON(Cc2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C17H17NO2/c19-12-16-13-20-18(11-14-7-3-1-4-8-14)17(16)15-9-5-2-6-10-15/h1-10,12,16-17H,11,13H2/t16-,17-/m1/s1 |
| InChIKey | YQDSALPUAQSGHT-IAGOWNOFSA-N |
| XLogP | 2.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (3S,4S)-2-benzyl-3-phenyl-1,2-oxazolidine-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-2-benzyl-3-phenyl-1,2-oxazolidine-4-carbaldehyde?
The IUPAC name of (3S,4S)-2-benzyl-3-phenyl-1,2-oxazolidine-4-carbaldehyde (CID 101359340) is (3S,4S)-2-benzyl-3-phenyl-1,2-oxazolidine-4-carbaldehyde.
What is the SMILES notation for (3S,4S)-2-benzyl-3-phenyl-1,2-oxazolidine-4-carbaldehyde?
The canonical SMILES for (3S,4S)-2-benzyl-3-phenyl-1,2-oxazolidine-4-carbaldehyde is O=C[C@@H]1CON(Cc2ccccc2)[C@@H]1c1ccccc1.
What is the InChIKey of (3S,4S)-2-benzyl-3-phenyl-1,2-oxazolidine-4-carbaldehyde?
The InChIKey is YQDSALPUAQSGHT-IAGOWNOFSA-N. The full InChI is InChI=1S/C17H17NO2/c19-12-16-13-20-18(11-14-7-3-1-4-8-14)17(16)15-9-5-2-6-10-15/h1-10,12,16-17H,11,13H2/t16-,17-/m1/s1.
What are the key properties of (3S,4S)-2-benzyl-3-phenyl-1,2-oxazolidine-4-carbaldehyde?
(3S,4S)-2-benzyl-3-phenyl-1,2-oxazolidine-4-carbaldehyde has a molecular weight of 267.33 g/mol, XLogP of 2.99, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-2-benzyl-3-phenyl-1,2-oxazolidine-4-carbaldehyde is sourced from PubChem (CID 101359340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).