C25H37NO11 — CID 101359390
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(2E)-3,7-dimethylocta-2,6-dienoxy]carbonylamino]oxan-2-yl]methyl acetate (PubChem CID 101359390) has the molecular formula C25H37NO11 and a molecular weight of 527.57 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(2E)-3,7-dimethylocta-2,6-dienoxy]carbonylamino]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(2E)-3,7-dimethylocta-2,6-dienoxy]carbonylamino]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101359390 |
| Molecular Formula | C25H37NO11 |
| Molecular Weight | 527.57 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[[(2E)-3,7-dimethylocta-2,6-dienoxy]carbonylamino]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](NC(=O)OC/C=C(\C)CCC=C(C)C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C25H37NO11/c1-14(2)9-8-10-15(3)11-12-32-25(31)26-24-23(36-19(7)30)22(35-18(6)29)21(34-17(5)28)20(37-24)13-33-16(4)27/h9,11,20-24H,8,10,12-13H2,1-7H3,(H,26,31)/b15-11+/t20-,21-,22+,23-,24-/m1/s1 |
| InChIKey | DNCONKHTJZQTCJ-KGDQROSGSA-N |
| XLogP | 2.49 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.57 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|