C27H30O4S — CID 101359437
(1'R,4'aS,9'aR)-1'-(benzenesulfonyl)-4'a-(2-phenylethynyl)spiro[1,3-dioxolane-2,3'-2,4,5,6,7,8,9,9a-octahydro-1H-benzo[7]annulene] (PubChem CID 101359437) has the molecular formula C27H30O4S and a molecular weight of 450.60 g/mol. Its IUPAC name is (1'R,4'aS,9'aR)-1'-(benzenesulfonyl)-4'a-(2-phenylethynyl)spiro[1,3-dioxolane-2,3'-2,4,5,6,7,8,9,9a-octahydro-1H-benzo[7]annulene].
| Compound Name | (1'R,4'aS,9'aR)-1'-(benzenesulfonyl)-4'a-(2-phenylethynyl)spiro[1,3-dioxolane-2,3'-2,4,5,6,7,8,9,9a-octahydro-1H-benzo[7]annulene] |
|---|---|
| PubChem CID | 101359437 |
| Molecular Formula | C27H30O4S |
| Molecular Weight | 450.60 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | (1'R,4'aS,9'aR)-1'-(benzenesulfonyl)-4'a-(2-phenylethynyl)spiro[1,3-dioxolane-2,3'-2,4,5,6,7,8,9,9a-octahydro-1H-benzo[7]annulene] |
| SMILES | O=S(=O)(c1ccccc1)[C@@H]1CC2(C[C@@]3(C#Cc4ccccc4)CCCCC[C@@H]13)OCCO2 |
| InChI | InChI=1S/C27H30O4S/c28-32(29,23-12-6-2-7-13-23)25-20-27(30-18-19-31-27)21-26(16-9-3-8-14-24(25)26)17-15-22-10-4-1-5-11-22/h1-2,4-7,10-13,24-25H,3,8-9,14,16,18-21H2/t24-,25+,26-/m0/s1 |
| InChIKey | FZICTQNZIKVPIC-NXCFDTQHSA-N |
| XLogP | 4.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.60 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|