About 1-methoxy-1'-methylspiro[cyclohexa-1,4-diene-6,3'-indole]-2'-one
1-methoxy-1'-methylspiro[cyclohexa-1,4-diene-6,3'-indole]-2'-one (PubChem CID 101359707) has the molecular formula C15H15NO2
and a molecular weight of 241.29 g/mol. Its IUPAC name is 1-methoxy-1'-methylspiro[cyclohexa-1,4-diene-6,3'-indole]-2'-one.
Molecular Properties
| Compound Name | 1-methoxy-1'-methylspiro[cyclohexa-1,4-diene-6,3'-indole]-2'-one |
| PubChem CID | 101359707 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 1-methoxy-1'-methylspiro[cyclohexa-1,4-diene-6,3'-indole]-2'-one |
| SMILES | COC1=CCC=CC12C(=O)N(C)c1ccccc12 |
| InChI | InChI=1S/C15H15NO2/c1-16-12-8-4-3-7-11(12)15(14(16)17)10-6-5-9-13(15)18-2/h3-4,6-10H,5H2,1-2H3 |
| InChIKey | BVIHQZANJQYBQS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-1'-methylspiro[cyclohexa-1,4-diene-6,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-1'-methylspiro[cyclohexa-1,4-diene-6,3'-indole]-2'-one?
The IUPAC name of 1-methoxy-1'-methylspiro[cyclohexa-1,4-diene-6,3'-indole]-2'-one (CID 101359707) is 1-methoxy-1'-methylspiro[cyclohexa-1,4-diene-6,3'-indole]-2'-one.
What is the SMILES notation for 1-methoxy-1'-methylspiro[cyclohexa-1,4-diene-6,3'-indole]-2'-one?
The canonical SMILES for 1-methoxy-1'-methylspiro[cyclohexa-1,4-diene-6,3'-indole]-2'-one is COC1=CCC=CC12C(=O)N(C)c1ccccc12.
What is the InChIKey of 1-methoxy-1'-methylspiro[cyclohexa-1,4-diene-6,3'-indole]-2'-one?
The InChIKey is BVIHQZANJQYBQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO2/c1-16-12-8-4-3-7-11(12)15(14(16)17)10-6-5-9-13(15)18-2/h3-4,6-10H,5H2,1-2H3.
What are the key properties of 1-methoxy-1'-methylspiro[cyclohexa-1,4-diene-6,3'-indole]-2'-one?
1-methoxy-1'-methylspiro[cyclohexa-1,4-diene-6,3'-indole]-2'-one has a molecular weight of 241.29 g/mol, XLogP of 2.39, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-1'-methylspiro[cyclohexa-1,4-diene-6,3'-indole]-2'-one is sourced from PubChem (CID 101359707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).