About 3-(3,4-difluorobenzoyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one
3-(3,4-difluorobenzoyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one (PubChem CID 10136003) has the molecular formula C20H16F2O5S
and a molecular weight of 406.41 g/mol. Its IUPAC name is 3-(3,4-difluorobenzoyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one.
Molecular Properties
| Compound Name | 3-(3,4-difluorobenzoyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one |
| PubChem CID | 10136003 |
| Molecular Formula | C20H16F2O5S |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.07 |
| IUPAC Name | 3-(3,4-difluorobenzoyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one |
| SMILES | CC1(C)OC(=O)C(C(=O)c2ccc(F)c(F)c2)=C1c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C20H16F2O5S/c1-20(2)17(11-4-7-13(8-5-11)28(3,25)26)16(19(24)27-20)18(23)12-6-9-14(21)15(22)10-12/h4-10H,1-3H3 |
| InChIKey | OPUNJHWLVLIRBS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,4-difluorobenzoyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-difluorobenzoyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one?
The IUPAC name of 3-(3,4-difluorobenzoyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one (CID 10136003) is 3-(3,4-difluorobenzoyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one.
What is the SMILES notation for 3-(3,4-difluorobenzoyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one?
The canonical SMILES for 3-(3,4-difluorobenzoyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one is CC1(C)OC(=O)C(C(=O)c2ccc(F)c(F)c2)=C1c1ccc(S(C)(=O)=O)cc1.
What is the InChIKey of 3-(3,4-difluorobenzoyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one?
The InChIKey is OPUNJHWLVLIRBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16F2O5S/c1-20(2)17(11-4-7-13(8-5-11)28(3,25)26)16(19(24)27-20)18(23)12-6-9-14(21)15(22)10-12/h4-10H,1-3H3.
What are the key properties of 3-(3,4-difluorobenzoyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one?
3-(3,4-difluorobenzoyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one has a molecular weight of 406.41 g/mol, XLogP of 3.34, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-difluorobenzoyl)-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one is sourced from PubChem (CID 10136003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).