C15H22O4 — CID 101360099
ethyl 2-[(1R,3R,5R)-3-ethenyl-8,8-dimethyl-2,9-dioxabicyclo[3.3.1]non-6-en-1-yl]acetate (PubChem CID 101360099) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is ethyl 2-[(1R,3R,5R)-3-ethenyl-8,8-dimethyl-2,9-dioxabicyclo[3.3.1]non-6-en-1-yl]acetate.
| Compound Name | ethyl 2-[(1R,3R,5R)-3-ethenyl-8,8-dimethyl-2,9-dioxabicyclo[3.3.1]non-6-en-1-yl]acetate |
|---|---|
| PubChem CID | 101360099 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | ethyl 2-[(1R,3R,5R)-3-ethenyl-8,8-dimethyl-2,9-dioxabicyclo[3.3.1]non-6-en-1-yl]acetate |
| SMILES | C=C[C@H]1C[C@@H]2C=CC(C)(C)[C@](CC(=O)OCC)(O1)O2 |
| InChI | InChI=1S/C15H22O4/c1-5-11-9-12-7-8-14(3,4)15(18-11,19-12)10-13(16)17-6-2/h5,7-8,11-12H,1,6,9-10H2,2-4H3/t11-,12-,15+/m0/s1 |
| InChIKey | CDCFEFLTEINJCZ-SLEUVZQESA-N |
| XLogP | 2.59 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|