C17H26O4 — CID 101360103
ethyl 2-[(4R,6R)-4,6-bis(ethenyl)-2-(2-methylbut-3-en-2-yl)-1,3-dioxan-2-yl]acetate (PubChem CID 101360103) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is ethyl 2-[(4R,6R)-4,6-bis(ethenyl)-2-(2-methylbut-3-en-2-yl)-1,3-dioxan-2-yl]acetate.
| Compound Name | ethyl 2-[(4R,6R)-4,6-bis(ethenyl)-2-(2-methylbut-3-en-2-yl)-1,3-dioxan-2-yl]acetate |
|---|---|
| PubChem CID | 101360103 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | ethyl 2-[(4R,6R)-4,6-bis(ethenyl)-2-(2-methylbut-3-en-2-yl)-1,3-dioxan-2-yl]acetate |
| SMILES | C=C[C@H]1C[C@H](C=C)OC(CC(=O)OCC)(C(C)(C)C=C)O1 |
| InChI | InChI=1S/C17H26O4/c1-7-13-11-14(8-2)21-17(20-13,16(5,6)9-3)12-15(18)19-10-4/h7-9,13-14H,1-3,10-12H2,4-6H3/t13-,14-/m0/s1 |
| InChIKey | YXLYVZGVNSRXHS-KBPBESRZSA-N |
| XLogP | 3.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|