C20H38OSi — CID 101360283
[(3E)-4,8-dimethylnona-1,3,7-trien-2-yl]oxy-tri(propan-2-yl)silane (PubChem CID 101360283) has the molecular formula C20H38OSi and a molecular weight of 322.61 g/mol. Its IUPAC name is [(3E)-4,8-dimethylnona-1,3,7-trien-2-yl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(3E)-4,8-dimethylnona-1,3,7-trien-2-yl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 101360283 |
| Molecular Formula | C20H38OSi |
| Molecular Weight | 322.61 g/mol |
| Exact Mass | 322.27 |
| IUPAC Name | [(3E)-4,8-dimethylnona-1,3,7-trien-2-yl]oxy-tri(propan-2-yl)silane |
| SMILES | C=C(/C=C(\C)CCC=C(C)C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H38OSi/c1-15(2)12-11-13-19(9)14-20(10)21-22(16(3)4,17(5)6)18(7)8/h12,14,16-18H,10-11,13H2,1-9H3/b19-14+ |
| InChIKey | FNADKAHXIGUGNJ-XMHGGMMESA-N |
| XLogP | 7.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.61 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|