C6H9F2N3O3 — CID 101360589
(2R,3R,4S,5R,6S)-2-(azidomethyl)-5,6-difluorooxane-3,4-diol (PubChem CID 101360589) has the molecular formula C6H9F2N3O3 and a molecular weight of 209.15 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-2-(azidomethyl)-5,6-difluorooxane-3,4-diol.
| Compound Name | (2R,3R,4S,5R,6S)-2-(azidomethyl)-5,6-difluorooxane-3,4-diol |
|---|---|
| PubChem CID | 101360589 |
| Molecular Formula | C6H9F2N3O3 |
| Molecular Weight | 209.15 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-(azidomethyl)-5,6-difluorooxane-3,4-diol |
| SMILES | [N-]=[N+]=NC[C@H]1O[C@@H](F)[C@H](F)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C6H9F2N3O3/c7-3-5(13)4(12)2(1-10-11-9)14-6(3)8/h2-6,12-13H,1H2/t2-,3-,4+,5-,6-/m1/s1 |
| InChIKey | ZQLMZQNHYJQCJC-VFUOTHLCSA-N |
| XLogP | 0.05 |
| TPSA | 98.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.15 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|