C15H13NO7 — CID 101360657
(2R,6S,7R,11S)-4,4-dimethyl-15-nitro-3,5,9-trioxatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),13,15-triene-8,10-dione (PubChem CID 101360657) has the molecular formula C15H13NO7 and a molecular weight of 319.27 g/mol. Its IUPAC name is (2R,6S,7R,11S)-4,4-dimethyl-15-nitro-3,5,9-trioxatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),13,15-triene-8,10-dione.
| Compound Name | (2R,6S,7R,11S)-4,4-dimethyl-15-nitro-3,5,9-trioxatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),13,15-triene-8,10-dione |
|---|---|
| PubChem CID | 101360657 |
| Molecular Formula | C15H13NO7 |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | (2R,6S,7R,11S)-4,4-dimethyl-15-nitro-3,5,9-trioxatetracyclo[10.4.0.02,6.07,11]hexadeca-1(12),13,15-triene-8,10-dione |
| SMILES | CC1(C)O[C@H]2[C@@H]3C(=O)OC(=O)[C@@H]3c3ccc([N+](=O)[O-])cc3[C@H]2O1 |
| InChI | InChI=1S/C15H13NO7/c1-15(2)22-11-8-5-6(16(19)20)3-4-7(8)9-10(12(11)23-15)14(18)21-13(9)17/h3-5,9-12H,1-2H3/t9-,10-,11-,12+/m1/s1 |
| InChIKey | OYVKDYXNLHQMMD-KKOKHZNYSA-N |
| XLogP | 1.58 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|