C13H18O — CID 101360682
(4aR,6aS,10aS)-2,3,4,4a,5,6a,9,10-octahydro-1H-benzo[c]inden-6-one (PubChem CID 101360682) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is (4aR,6aS,10aS)-2,3,4,4a,5,6a,9,10-octahydro-1H-benzo[c]inden-6-one.
| Compound Name | (4aR,6aS,10aS)-2,3,4,4a,5,6a,9,10-octahydro-1H-benzo[c]inden-6-one |
|---|---|
| PubChem CID | 101360682 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | (4aR,6aS,10aS)-2,3,4,4a,5,6a,9,10-octahydro-1H-benzo[c]inden-6-one |
| SMILES | O=C1C[C@H]2CCCC[C@]23CCC=C[C@H]13 |
| InChI | InChI=1S/C13H18O/c14-12-9-10-5-1-3-7-13(10)8-4-2-6-11(12)13/h2,6,10-11H,1,3-5,7-9H2/t10-,11-,13+/m1/s1 |
| InChIKey | SCZODJFCFDPLAE-WZRBSPASSA-N |
| XLogP | 3.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|