About (1R,5S)-4-chloro-2,2-dimethoxy-8-oxabicyclo[3.2.1]oct-6-en-3-one
(1R,5S)-4-chloro-2,2-dimethoxy-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 101360973) has the molecular formula C9H11ClO4
and a molecular weight of 218.64 g/mol. Its IUPAC name is (1R,5S)-4-chloro-2,2-dimethoxy-8-oxabicyclo[3.2.1]oct-6-en-3-one.
Molecular Properties
| Compound Name | (1R,5S)-4-chloro-2,2-dimethoxy-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| PubChem CID | 101360973 |
| Molecular Formula | C9H11ClO4 |
| Molecular Weight | 218.64 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | (1R,5S)-4-chloro-2,2-dimethoxy-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | COC1(OC)C(=O)C(Cl)[C@@H]2C=C[C@H]1O2 |
| InChI | InChI=1S/C9H11ClO4/c1-12-9(13-2)6-4-3-5(14-6)7(10)8(9)11/h3-7H,1-2H3/t5-,6+,7?/m0/s1 |
| InChIKey | OLHMIMPEOVZXFB-GFCOJPQKSA-N |
| XLogP | 0.49 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.64 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1R,5S)-4-chloro-2,2-dimethoxy-8-oxabicyclo[3.2.1]oct-6-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,5S)-4-chloro-2,2-dimethoxy-8-oxabicyclo[3.2.1]oct-6-en-3-one?
The IUPAC name of (1R,5S)-4-chloro-2,2-dimethoxy-8-oxabicyclo[3.2.1]oct-6-en-3-one (CID 101360973) is (1R,5S)-4-chloro-2,2-dimethoxy-8-oxabicyclo[3.2.1]oct-6-en-3-one.
What is the SMILES notation for (1R,5S)-4-chloro-2,2-dimethoxy-8-oxabicyclo[3.2.1]oct-6-en-3-one?
The canonical SMILES for (1R,5S)-4-chloro-2,2-dimethoxy-8-oxabicyclo[3.2.1]oct-6-en-3-one is COC1(OC)C(=O)C(Cl)[C@@H]2C=C[C@H]1O2.
What is the InChIKey of (1R,5S)-4-chloro-2,2-dimethoxy-8-oxabicyclo[3.2.1]oct-6-en-3-one?
The InChIKey is OLHMIMPEOVZXFB-GFCOJPQKSA-N. The full InChI is InChI=1S/C9H11ClO4/c1-12-9(13-2)6-4-3-5(14-6)7(10)8(9)11/h3-7H,1-2H3/t5-,6+,7?/m0/s1.
What are the key properties of (1R,5S)-4-chloro-2,2-dimethoxy-8-oxabicyclo[3.2.1]oct-6-en-3-one?
(1R,5S)-4-chloro-2,2-dimethoxy-8-oxabicyclo[3.2.1]oct-6-en-3-one has a molecular weight of 218.64 g/mol, XLogP of 0.49, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,5S)-4-chloro-2,2-dimethoxy-8-oxabicyclo[3.2.1]oct-6-en-3-one is sourced from PubChem (CID 101360973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).