C13H19O6P — CID 101361053
[(2R,3S,5R)-5-(2,5-dimethylphenyl)-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate (PubChem CID 101361053) has the molecular formula C13H19O6P and a molecular weight of 302.26 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(2,5-dimethylphenyl)-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate.
| Compound Name | [(2R,3S,5R)-5-(2,5-dimethylphenyl)-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 101361053 |
| Molecular Formula | C13H19O6P |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | [(2R,3S,5R)-5-(2,5-dimethylphenyl)-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate |
| SMILES | Cc1ccc(C)c([C@H]2C[C@H](OP(=O)(O)O)[C@@H](CO)O2)c1 |
| InChI | InChI=1S/C13H19O6P/c1-8-3-4-9(2)10(5-8)11-6-12(13(7-14)18-11)19-20(15,16)17/h3-5,11-14H,6-7H2,1-2H3,(H2,15,16,17)/t11-,12+,13-/m1/s1 |
| InChIKey | KJTYDGKLKKQDSC-FRRDWIJNSA-N |
| XLogP | 1.60 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|