C15H21NO5 — CID 101361209
ethyl (1S,6S)-3,4-dimethyl-6-(2-oxo-1,3-oxazolidine-3-carbonyl)cyclohex-3-ene-1-carboxylate (PubChem CID 101361209) has the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. Its IUPAC name is ethyl (1S,6S)-3,4-dimethyl-6-(2-oxo-1,3-oxazolidine-3-carbonyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1S,6S)-3,4-dimethyl-6-(2-oxo-1,3-oxazolidine-3-carbonyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 101361209 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | ethyl (1S,6S)-3,4-dimethyl-6-(2-oxo-1,3-oxazolidine-3-carbonyl)cyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1CC(C)=C(C)C[C@@H]1C(=O)N1CCOC1=O |
| InChI | InChI=1S/C15H21NO5/c1-4-20-14(18)12-8-10(3)9(2)7-11(12)13(17)16-5-6-21-15(16)19/h11-12H,4-8H2,1-3H3/t11-,12-/m0/s1 |
| InChIKey | LXFGFMGLCBMGNY-RYUDHWBXSA-N |
| XLogP | 1.89 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|