About 4-(1-butyl-3,6-dihydro-2H-pyridin-5-yl)butan-2-ol
4-(1-butyl-3,6-dihydro-2H-pyridin-5-yl)butan-2-ol (PubChem CID 101361283) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is 4-(1-butyl-3,6-dihydro-2H-pyridin-5-yl)butan-2-ol.
Molecular Properties
| Compound Name | 4-(1-butyl-3,6-dihydro-2H-pyridin-5-yl)butan-2-ol |
| PubChem CID | 101361283 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | 4-(1-butyl-3,6-dihydro-2H-pyridin-5-yl)butan-2-ol |
| SMILES | CCCCN1CCC=C(CCC(C)O)C1 |
| InChI | InChI=1S/C13H25NO/c1-3-4-9-14-10-5-6-13(11-14)8-7-12(2)15/h6,12,15H,3-5,7-11H2,1-2H3 |
| InChIKey | CPDVHKBZLQLMKI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-butyl-3,6-dihydro-2H-pyridin-5-yl)butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-butyl-3,6-dihydro-2H-pyridin-5-yl)butan-2-ol?
The IUPAC name of 4-(1-butyl-3,6-dihydro-2H-pyridin-5-yl)butan-2-ol (CID 101361283) is 4-(1-butyl-3,6-dihydro-2H-pyridin-5-yl)butan-2-ol.
What is the SMILES notation for 4-(1-butyl-3,6-dihydro-2H-pyridin-5-yl)butan-2-ol?
The canonical SMILES for 4-(1-butyl-3,6-dihydro-2H-pyridin-5-yl)butan-2-ol is CCCCN1CCC=C(CCC(C)O)C1.
What is the InChIKey of 4-(1-butyl-3,6-dihydro-2H-pyridin-5-yl)butan-2-ol?
The InChIKey is CPDVHKBZLQLMKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO/c1-3-4-9-14-10-5-6-13(11-14)8-7-12(2)15/h6,12,15H,3-5,7-11H2,1-2H3.
What are the key properties of 4-(1-butyl-3,6-dihydro-2H-pyridin-5-yl)butan-2-ol?
4-(1-butyl-3,6-dihydro-2H-pyridin-5-yl)butan-2-ol has a molecular weight of 211.35 g/mol, XLogP of 2.58, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-butyl-3,6-dihydro-2H-pyridin-5-yl)butan-2-ol is sourced from PubChem (CID 101361283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).