C15H20O10 — CID 101361535
(2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-prop-2-enoxyoxane-2-carboxylic acid (PubChem CID 101361535) has the molecular formula C15H20O10 and a molecular weight of 360.32 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-prop-2-enoxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-prop-2-enoxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 101361535 |
| Molecular Formula | C15H20O10 |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-prop-2-enoxyoxane-2-carboxylic acid |
| SMILES | C=CCO[C@H]1O[C@H](C(=O)O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C15H20O10/c1-5-6-21-15-13(24-9(4)18)11(23-8(3)17)10(22-7(2)16)12(25-15)14(19)20/h5,10-13,15H,1,6H2,2-4H3,(H,19,20)/t10-,11-,12-,13+,15-/m0/s1 |
| InChIKey | SJMSHTIWMJVJEY-BAYHKCFCSA-N |
| XLogP | -0.21 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|