C15H18F3NO4S — CID 101361721
ethyl 3-[2-nitro-4-(trifluoromethyl)phenyl]-3-propylsulfanylpropanoate (PubChem CID 101361721) has the molecular formula C15H18F3NO4S and a molecular weight of 365.37 g/mol. Its IUPAC name is ethyl 3-[2-nitro-4-(trifluoromethyl)phenyl]-3-propylsulfanylpropanoate.
| Compound Name | ethyl 3-[2-nitro-4-(trifluoromethyl)phenyl]-3-propylsulfanylpropanoate |
|---|---|
| PubChem CID | 101361721 |
| Molecular Formula | C15H18F3NO4S |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | ethyl 3-[2-nitro-4-(trifluoromethyl)phenyl]-3-propylsulfanylpropanoate |
| SMILES | CCCSC(CC(=O)OCC)c1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H18F3NO4S/c1-3-7-24-13(9-14(20)23-4-2)11-6-5-10(15(16,17)18)8-12(11)19(21)22/h5-6,8,13H,3-4,7,9H2,1-2H3 |
| InChIKey | CSLXFGPBNDPRLH-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|