C20H38O4Si — CID 101361792
(4S)-4-hydroxy-5,5-dimethyl-1-[(6Z,8R)-7-methyl-2,2-di(propan-2-yl)-5,8-dihydro-4H-1,3,2-dioxasilocin-8-yl]hexan-2-one (PubChem CID 101361792) has the molecular formula C20H38O4Si and a molecular weight of 370.61 g/mol. Its IUPAC name is (4S)-4-hydroxy-5,5-dimethyl-1-[(6Z,8R)-7-methyl-2,2-di(propan-2-yl)-5,8-dihydro-4H-1,3,2-dioxasilocin-8-yl]hexan-2-one.
| Compound Name | (4S)-4-hydroxy-5,5-dimethyl-1-[(6Z,8R)-7-methyl-2,2-di(propan-2-yl)-5,8-dihydro-4H-1,3,2-dioxasilocin-8-yl]hexan-2-one |
|---|---|
| PubChem CID | 101361792 |
| Molecular Formula | C20H38O4Si |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | (4S)-4-hydroxy-5,5-dimethyl-1-[(6Z,8R)-7-methyl-2,2-di(propan-2-yl)-5,8-dihydro-4H-1,3,2-dioxasilocin-8-yl]hexan-2-one |
| SMILES | C/C1=C/CCO[Si](C(C)C)(C(C)C)O[C@@H]1CC(=O)C[C@H](O)C(C)(C)C |
| InChI | InChI=1S/C20H38O4Si/c1-14(2)25(15(3)4)23-11-9-10-16(5)18(24-25)12-17(21)13-19(22)20(6,7)8/h10,14-15,18-19,22H,9,11-13H2,1-8H3/b16-10-/t18-,19+/m1/s1 |
| InChIKey | VBPVCWNCNIRWIN-WFNWROLRSA-N |
| XLogP | 4.76 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|