C10H8BrF3O2 — CID 101361849
8-bromo-5-(trifluoromethyl)-3,4-dihydro-2H-chromen-7-ol (PubChem CID 101361849) has the molecular formula C10H8BrF3O2 and a molecular weight of 297.07 g/mol. Its IUPAC name is 8-bromo-5-(trifluoromethyl)-3,4-dihydro-2H-chromen-7-ol.
| Compound Name | 8-bromo-5-(trifluoromethyl)-3,4-dihydro-2H-chromen-7-ol |
|---|---|
| PubChem CID | 101361849 |
| Molecular Formula | C10H8BrF3O2 |
| Molecular Weight | 297.07 g/mol |
| Exact Mass | 295.97 |
| IUPAC Name | 8-bromo-5-(trifluoromethyl)-3,4-dihydro-2H-chromen-7-ol |
| SMILES | Oc1cc(C(F)(F)F)c2c(c1Br)OCCC2 |
| InChI | InChI=1S/C10H8BrF3O2/c11-8-7(15)4-6(10(12,13)14)5-2-1-3-16-9(5)8/h4,15H,1-3H2 |
| InChIKey | UPAIMBNYMYTOFW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.07 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |